C20H22N2OS — CID 171294727
1-[(S)-(2-methoxynaphthalen-1-yl)-thiophen-2-ylmethyl]piperazine (PubChem CID 171294727) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is 1-[(S)-(2-methoxynaphthalen-1-yl)-thiophen-2-ylmethyl]piperazine.
| Compound Name | 1-[(S)-(2-methoxynaphthalen-1-yl)-thiophen-2-ylmethyl]piperazine |
|---|---|
| PubChem CID | 171294727 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-[(S)-(2-methoxynaphthalen-1-yl)-thiophen-2-ylmethyl]piperazine |
| SMILES | COc1ccc2ccccc2c1[C@@H](c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C20H22N2OS/c1-23-17-9-8-15-5-2-3-6-16(15)19(17)20(18-7-4-14-24-18)22-12-10-21-11-13-22/h2-9,14,20-21H,10-13H2,1H3/t20-/m1/s1 |
| InChIKey | XPTWYMBCAAEFMC-HXUWFJFHSA-N |
| XLogP | 3.90 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |