C19H26N2O2S — CID 3746492
1-[(3-ethoxy-4-methoxyphenyl)-thiophen-2-ylmethyl]-1,4-diazepane (PubChem CID 3746492) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-[(3-ethoxy-4-methoxyphenyl)-thiophen-2-ylmethyl]-1,4-diazepane.
| Compound Name | 1-[(3-ethoxy-4-methoxyphenyl)-thiophen-2-ylmethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3746492 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[(3-ethoxy-4-methoxyphenyl)-thiophen-2-ylmethyl]-1,4-diazepane |
| SMILES | CCOc1cc(C(c2cccs2)N2CCCNCC2)ccc1OC |
| InChI | InChI=1S/C19H26N2O2S/c1-3-23-17-14-15(7-8-16(17)22-2)19(18-6-4-13-24-18)21-11-5-9-20-10-12-21/h4,6-8,13-14,19-20H,3,5,9-12H2,1-2H3 |
| InChIKey | IJVXLEIUPCGLCN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |