C15H18Br2Cl2N2S — CID 171296235
1-[(S)-(2,5-dibromophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride (PubChem CID 171296235) has the molecular formula C15H18Br2Cl2N2S and a molecular weight of 489.10 g/mol. Its IUPAC name is 1-[(S)-(2,5-dibromophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(2,5-dibromophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171296235 |
| Molecular Formula | C15H18Br2Cl2N2S |
| Molecular Weight | 489.10 g/mol |
| Exact Mass | 485.89 |
| IUPAC Name | 1-[(S)-(2,5-dibromophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
| SMILES | Brc1ccc(Br)c([C@@H](c2cccs2)N2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C15H16Br2N2S.2ClH/c16-11-3-4-13(17)12(10-11)15(14-2-1-9-20-14)19-7-5-18-6-8-19;;/h1-4,9-10,15,18H,5-8H2;2*1H/t15-;;/m0../s1 |
| InChIKey | SVIKXBATWMMAFX-CKUXDGONSA-N |
| XLogP | 5.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.10 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |