C18H23BrN2OS — CID 3767577
1-[(5-bromothiophen-2-yl)-(4-ethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 3767577) has the molecular formula C18H23BrN2OS and a molecular weight of 395.37 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-(4-ethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(5-bromothiophen-2-yl)-(4-ethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3767577 |
| Molecular Formula | C18H23BrN2OS |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-(4-ethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | CCOc1ccc(C(c2ccc(Br)s2)N2CCCNCC2)cc1 |
| InChI | InChI=1S/C18H23BrN2OS/c1-2-22-15-6-4-14(5-7-15)18(16-8-9-17(19)23-16)21-12-3-10-20-11-13-21/h4-9,18,20H,2-3,10-13H2,1H3 |
| InChIKey | HLDVLQMKAKHIBA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |