C18H23BrN2O2S — CID 3800936
1-[(5-bromothiophen-2-yl)-(2,6-dimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 3800936) has the molecular formula C18H23BrN2O2S and a molecular weight of 411.37 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-(2,6-dimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(5-bromothiophen-2-yl)-(2,6-dimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3800936 |
| Molecular Formula | C18H23BrN2O2S |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-(2,6-dimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1cccc(OC)c1C(c1ccc(Br)s1)N1CCCNCC1 |
| InChI | InChI=1S/C18H23BrN2O2S/c1-22-13-5-3-6-14(23-2)17(13)18(15-7-8-16(19)24-15)21-11-4-9-20-10-12-21/h3,5-8,18,20H,4,9-12H2,1-2H3 |
| InChIKey | ZEVKDCQJQPGQDI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |