C22H30N2O4 — CID 5159429
1-[(2,3-dimethoxyphenyl)-(2,6-dimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 5159429) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-[(2,3-dimethoxyphenyl)-(2,6-dimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(2,3-dimethoxyphenyl)-(2,6-dimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 5159429 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1-[(2,3-dimethoxyphenyl)-(2,6-dimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1cccc(C(c2c(OC)cccc2OC)N2CCCNCC2)c1OC |
| InChI | InChI=1S/C22H30N2O4/c1-25-17-9-6-10-18(26-2)20(17)21(24-14-7-12-23-13-15-24)16-8-5-11-19(27-3)22(16)28-4/h5-6,8-11,21,23H,7,12-15H2,1-4H3 |
| InChIKey | CUYYYEXNYGMQOF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |