C19H22F2N2O2 — CID 3831284
1-[(2,4-difluorophenyl)-(2,3-dimethoxyphenyl)methyl]piperazine (PubChem CID 3831284) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)-(2,3-dimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(2,4-difluorophenyl)-(2,3-dimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3831284 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[(2,4-difluorophenyl)-(2,3-dimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cccc(C(c2ccc(F)cc2F)N2CCNCC2)c1OC |
| InChI | InChI=1S/C19H22F2N2O2/c1-24-17-5-3-4-15(19(17)25-2)18(23-10-8-22-9-11-23)14-7-6-13(20)12-16(14)21/h3-7,12,18,22H,8-11H2,1-2H3 |
| InChIKey | XJAMJJCQYYNMPA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |