C20H24F2N2O3 — CID 4306494
1-[(2,4-difluorophenyl)-(2,3,4-trimethoxyphenyl)methyl]piperazine (PubChem CID 4306494) has the molecular formula C20H24F2N2O3 and a molecular weight of 378.42 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)-(2,3,4-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(2,4-difluorophenyl)-(2,3,4-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 4306494 |
| Molecular Formula | C20H24F2N2O3 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-[(2,4-difluorophenyl)-(2,3,4-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(C(c2ccc(F)cc2F)N2CCNCC2)c(OC)c1OC |
| InChI | InChI=1S/C20H24F2N2O3/c1-25-17-7-6-15(19(26-2)20(17)27-3)18(24-10-8-23-9-11-24)14-5-4-13(21)12-16(14)22/h4-7,12,18,23H,8-11H2,1-3H3 |
| InChIKey | VMUUJNGRJZTRBS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |