C18H20F2N2 — CID 5211838
1-[(2,4-difluorophenyl)-(4-methylphenyl)methyl]piperazine (PubChem CID 5211838) has the molecular formula C18H20F2N2 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)-(4-methylphenyl)methyl]piperazine.
| Compound Name | 1-[(2,4-difluorophenyl)-(4-methylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 5211838 |
| Molecular Formula | C18H20F2N2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-[(2,4-difluorophenyl)-(4-methylphenyl)methyl]piperazine |
| SMILES | Cc1ccc(C(c2ccc(F)cc2F)N2CCNCC2)cc1 |
| InChI | InChI=1S/C18H20F2N2/c1-13-2-4-14(5-3-13)18(22-10-8-21-9-11-22)16-7-6-15(19)12-17(16)20/h2-7,12,18,21H,8-11H2,1H3 |
| InChIKey | HWVYSXYDWSEFSA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |