C20H24F2N2 — CID 5130926
1-[(2,4-difluorophenyl)-(2,4-dimethylphenyl)methyl]-1,4-diazepane (PubChem CID 5130926) has the molecular formula C20H24F2N2 and a molecular weight of 330.42 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)-(2,4-dimethylphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(2,4-difluorophenyl)-(2,4-dimethylphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 5130926 |
| Molecular Formula | C20H24F2N2 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-[(2,4-difluorophenyl)-(2,4-dimethylphenyl)methyl]-1,4-diazepane |
| SMILES | Cc1ccc(C(c2ccc(F)cc2F)N2CCCNCC2)c(C)c1 |
| InChI | InChI=1S/C20H24F2N2/c1-14-4-6-17(15(2)12-14)20(24-10-3-8-23-9-11-24)18-7-5-16(21)13-19(18)22/h4-7,12-13,20,23H,3,8-11H2,1-2H3 |
| InChIKey | JMHSQGZIZCUYMF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |