C19H22F2N2O — CID 3970423
1-[(2,4-difluorophenyl)-(3-ethoxyphenyl)methyl]piperazine (PubChem CID 3970423) has the molecular formula C19H22F2N2O and a molecular weight of 332.39 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)-(3-ethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(2,4-difluorophenyl)-(3-ethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3970423 |
| Molecular Formula | C19H22F2N2O |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-[(2,4-difluorophenyl)-(3-ethoxyphenyl)methyl]piperazine |
| SMILES | CCOc1cccc(C(c2ccc(F)cc2F)N2CCNCC2)c1 |
| InChI | InChI=1S/C19H22F2N2O/c1-2-24-16-5-3-4-14(12-16)19(23-10-8-22-9-11-23)17-7-6-15(20)13-18(17)21/h3-7,12-13,19,22H,2,8-11H2,1H3 |
| InChIKey | DDZKPPMAMXAXFW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |