C21H27FN2O4 — CID 4538369
1-[(5-fluoro-2-methoxyphenyl)-(3,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 4538369) has the molecular formula C21H27FN2O4 and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-[(5-fluoro-2-methoxyphenyl)-(3,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(5-fluoro-2-methoxyphenyl)-(3,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 4538369 |
| Molecular Formula | C21H27FN2O4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 1-[(5-fluoro-2-methoxyphenyl)-(3,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(F)cc1C(c1cc(OC)c(OC)c(OC)c1)N1CCNCC1 |
| InChI | InChI=1S/C21H27FN2O4/c1-25-17-6-5-15(22)13-16(17)20(24-9-7-23-8-10-24)14-11-18(26-2)21(28-4)19(12-14)27-3/h5-6,11-13,20,23H,7-10H2,1-4H3 |
| InChIKey | JGCWWQADKXKMNS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |