C19H21FN2O3 — CID 3398126
1-[1,3-benzodioxol-5-yl-(5-fluoro-2-methoxyphenyl)methyl]piperazine (PubChem CID 3398126) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-[1,3-benzodioxol-5-yl-(5-fluoro-2-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-[1,3-benzodioxol-5-yl-(5-fluoro-2-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3398126 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-[1,3-benzodioxol-5-yl-(5-fluoro-2-methoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(F)cc1C(c1ccc2c(c1)OCO2)N1CCNCC1 |
| InChI | InChI=1S/C19H21FN2O3/c1-23-16-5-3-14(20)11-15(16)19(22-8-6-21-7-9-22)13-2-4-17-18(10-13)25-12-24-17/h2-5,10-11,19,21H,6-9,12H2,1H3 |
| InChIKey | LXQPKYOAJGQAGU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |