C21H28N2O4 — CID 5234749
1-[(2,5-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]piperazine (PubChem CID 5234749) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[(2,5-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(2,5-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 5234749 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-[(2,5-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(OC)c(C(c2ccc(OC)c(OC)c2)N2CCNCC2)c1 |
| InChI | InChI=1S/C21H28N2O4/c1-24-16-6-8-18(25-2)17(14-16)21(23-11-9-22-10-12-23)15-5-7-19(26-3)20(13-15)27-4/h5-8,13-14,21-22H,9-12H2,1-4H3 |
| InChIKey | JDDCBPYYUCZSIZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |