C19H23ClN2O2 — CID 3758150
1-[(4-chlorophenyl)-(2,5-dimethoxyphenyl)methyl]piperazine (PubChem CID 3758150) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-(2,5-dimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(4-chlorophenyl)-(2,5-dimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3758150 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[(4-chlorophenyl)-(2,5-dimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(OC)c(C(c2ccc(Cl)cc2)N2CCNCC2)c1 |
| InChI | InChI=1S/C19H23ClN2O2/c1-23-16-7-8-18(24-2)17(13-16)19(22-11-9-21-10-12-22)14-3-5-15(20)6-4-14/h3-8,13,19,21H,9-12H2,1-2H3 |
| InChIKey | HJGWDJFBMIMOFM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |