C19H23ClN2O — CID 4738663
1-[(4-chlorophenyl)-(4-methoxy-2-methylphenyl)methyl]piperazine (PubChem CID 4738663) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-(4-methoxy-2-methylphenyl)methyl]piperazine.
| Compound Name | 1-[(4-chlorophenyl)-(4-methoxy-2-methylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 4738663 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-[(4-chlorophenyl)-(4-methoxy-2-methylphenyl)methyl]piperazine |
| SMILES | COc1ccc(C(c2ccc(Cl)cc2)N2CCNCC2)c(C)c1 |
| InChI | InChI=1S/C19H23ClN2O/c1-14-13-17(23-2)7-8-18(14)19(22-11-9-21-10-12-22)15-3-5-16(20)6-4-15/h3-8,13,19,21H,9-12H2,1-2H3 |
| InChIKey | OKJAAIQOPKXFQO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |