C19H23ClN2 — CID 4312226
1-[(4-chlorophenyl)-(2,5-dimethylphenyl)methyl]piperazine (PubChem CID 4312226) has the molecular formula C19H23ClN2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-(2,5-dimethylphenyl)methyl]piperazine.
| Compound Name | 1-[(4-chlorophenyl)-(2,5-dimethylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 4312226 |
| Molecular Formula | C19H23ClN2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-[(4-chlorophenyl)-(2,5-dimethylphenyl)methyl]piperazine |
| SMILES | Cc1ccc(C)c(C(c2ccc(Cl)cc2)N2CCNCC2)c1 |
| InChI | InChI=1S/C19H23ClN2/c1-14-3-4-15(2)18(13-14)19(22-11-9-21-10-12-22)16-5-7-17(20)8-6-16/h3-8,13,19,21H,9-12H2,1-2H3 |
| InChIKey | UOIVWMGSOWKULG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |