C21H27ClN2O3 — CID 3847028
1-[(5-chloro-2-methoxyphenyl)-(2,5-dimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 3847028) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is 1-[(5-chloro-2-methoxyphenyl)-(2,5-dimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(5-chloro-2-methoxyphenyl)-(2,5-dimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3847028 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[(5-chloro-2-methoxyphenyl)-(2,5-dimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1ccc(OC)c(C(c2cc(Cl)ccc2OC)N2CCCNCC2)c1 |
| InChI | InChI=1S/C21H27ClN2O3/c1-25-16-6-8-20(27-3)18(14-16)21(24-11-4-9-23-10-12-24)17-13-15(22)5-7-19(17)26-2/h5-8,13-14,21,23H,4,9-12H2,1-3H3 |
| InChIKey | BHBLGVZJIYLMPZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |