C20H28N2O2S — CID 3501373
1-[(2,5-dimethoxyphenyl)-(5-ethylthiophen-2-yl)methyl]-1,4-diazepane (PubChem CID 3501373) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is 1-[(2,5-dimethoxyphenyl)-(5-ethylthiophen-2-yl)methyl]-1,4-diazepane.
| Compound Name | 1-[(2,5-dimethoxyphenyl)-(5-ethylthiophen-2-yl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3501373 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 1-[(2,5-dimethoxyphenyl)-(5-ethylthiophen-2-yl)methyl]-1,4-diazepane |
| SMILES | CCc1ccc(C(c2cc(OC)ccc2OC)N2CCCNCC2)s1 |
| InChI | InChI=1S/C20H28N2O2S/c1-4-16-7-9-19(25-16)20(22-12-5-10-21-11-13-22)17-14-15(23-2)6-8-18(17)24-3/h6-9,14,20-21H,4-5,10-13H2,1-3H3 |
| InChIKey | YRCCDQAXFLHCRR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |