C17H21BrN2O2S — CID 3835011
1-[(5-bromothiophen-2-yl)-(2,4-dimethoxyphenyl)methyl]piperazine (PubChem CID 3835011) has the molecular formula C17H21BrN2O2S and a molecular weight of 397.34 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-(2,4-dimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(5-bromothiophen-2-yl)-(2,4-dimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3835011 |
| Molecular Formula | C17H21BrN2O2S |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-(2,4-dimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(C(c2ccc(Br)s2)N2CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C17H21BrN2O2S/c1-21-12-3-4-13(14(11-12)22-2)17(15-5-6-16(18)23-15)20-9-7-19-8-10-20/h3-6,11,17,19H,7-10H2,1-2H3 |
| InChIKey | PLKQWXUTCNJQIF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |