C20H25BrN2O2 — CID 3490266
1-[(2-bromophenyl)-(2,4-dimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 3490266) has the molecular formula C20H25BrN2O2 and a molecular weight of 405.34 g/mol. Its IUPAC name is 1-[(2-bromophenyl)-(2,4-dimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(2-bromophenyl)-(2,4-dimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3490266 |
| Molecular Formula | C20H25BrN2O2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-[(2-bromophenyl)-(2,4-dimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1ccc(C(c2ccccc2Br)N2CCCNCC2)c(OC)c1 |
| InChI | InChI=1S/C20H25BrN2O2/c1-24-15-8-9-17(19(14-15)25-2)20(16-6-3-4-7-18(16)21)23-12-5-10-22-11-13-23/h3-4,6-9,14,20,22H,5,10-13H2,1-2H3 |
| InChIKey | WEQCFHSDHXVKAO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |