C18H20Br2N2 — CID 4295323
1-[bis(2-bromophenyl)methyl]-1,4-diazepane (PubChem CID 4295323) has the molecular formula C18H20Br2N2 and a molecular weight of 424.18 g/mol. Its IUPAC name is 1-[bis(2-bromophenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[bis(2-bromophenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 4295323 |
| Molecular Formula | C18H20Br2N2 |
| Molecular Weight | 424.18 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | 1-[bis(2-bromophenyl)methyl]-1,4-diazepane |
| SMILES | Brc1ccccc1C(c1ccccc1Br)N1CCCNCC1 |
| InChI | InChI=1S/C18H20Br2N2/c19-16-8-3-1-6-14(16)18(15-7-2-4-9-17(15)20)22-12-5-10-21-11-13-22/h1-4,6-9,18,21H,5,10-13H2 |
| InChIKey | OFEIFGXYNCQRNA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.18 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |