C21H26N2O4 — CID 3714550
1-[1,3-benzodioxol-5-yl-(2,4-dimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 3714550) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[1,3-benzodioxol-5-yl-(2,4-dimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[1,3-benzodioxol-5-yl-(2,4-dimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3714550 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[1,3-benzodioxol-5-yl-(2,4-dimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1ccc(C(c2ccc3c(c2)OCO3)N2CCCNCC2)c(OC)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-24-16-5-6-17(19(13-16)25-2)21(23-10-3-8-22-9-11-23)15-4-7-18-20(12-15)27-14-26-18/h4-7,12-13,21-22H,3,8-11,14H2,1-2H3 |
| InChIKey | SYRGSSCPEDTJFS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |