C22H25N3O2 — CID 5134907
6-[(2,4-dimethoxyphenyl)-piperazin-1-ylmethyl]isoquinoline (PubChem CID 5134907) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 6-[(2,4-dimethoxyphenyl)-piperazin-1-ylmethyl]isoquinoline.
| Compound Name | 6-[(2,4-dimethoxyphenyl)-piperazin-1-ylmethyl]isoquinoline |
|---|---|
| PubChem CID | 5134907 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 6-[(2,4-dimethoxyphenyl)-piperazin-1-ylmethyl]isoquinoline |
| SMILES | COc1ccc(C(c2ccc3cnccc3c2)N2CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-26-19-5-6-20(21(14-19)27-2)22(25-11-9-23-10-12-25)17-3-4-18-15-24-8-7-16(18)13-17/h3-8,13-15,22-23H,9-12H2,1-2H3 |
| InChIKey | AWEQRMOKAWRSBL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |