C26H30N2O3 — CID 3321312
1-[(2,4-dimethoxyphenyl)-(4-phenylmethoxyphenyl)methyl]piperazine (PubChem CID 3321312) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)-(4-phenylmethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)-(4-phenylmethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3321312 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)-(4-phenylmethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(C(c2ccc(OCc3ccccc3)cc2)N2CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C26H30N2O3/c1-29-23-12-13-24(25(18-23)30-2)26(28-16-14-27-15-17-28)21-8-10-22(11-9-21)31-19-20-6-4-3-5-7-20/h3-13,18,26-27H,14-17,19H2,1-2H3 |
| InChIKey | HYWODSJPDGPUQF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |