C24H24Cl2N2O — CID 3779919
1-[(2,4-dichlorophenyl)-(4-phenylmethoxyphenyl)methyl]piperazine (PubChem CID 3779919) has the molecular formula C24H24Cl2N2O and a molecular weight of 427.38 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)-(4-phenylmethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(2,4-dichlorophenyl)-(4-phenylmethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3779919 |
| Molecular Formula | C24H24Cl2N2O |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)-(4-phenylmethoxyphenyl)methyl]piperazine |
| SMILES | Clc1ccc(C(c2ccc(OCc3ccccc3)cc2)N2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C24H24Cl2N2O/c25-20-8-11-22(23(26)16-20)24(28-14-12-27-13-15-28)19-6-9-21(10-7-19)29-17-18-4-2-1-3-5-18/h1-11,16,24,27H,12-15,17H2 |
| InChIKey | SCTTVPNBVDQWOZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |