C23H22Cl2N2O — CID 3597593
1-[(2,4-dichlorophenyl)-(3-phenoxyphenyl)methyl]piperazine (PubChem CID 3597593) has the molecular formula C23H22Cl2N2O and a molecular weight of 413.35 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)-(3-phenoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(2,4-dichlorophenyl)-(3-phenoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3597593 |
| Molecular Formula | C23H22Cl2N2O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)-(3-phenoxyphenyl)methyl]piperazine |
| SMILES | Clc1ccc(C(c2cccc(Oc3ccccc3)c2)N2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C23H22Cl2N2O/c24-18-9-10-21(22(25)16-18)23(27-13-11-26-12-14-27)17-5-4-8-20(15-17)28-19-6-2-1-3-7-19/h1-10,15-16,23,26H,11-14H2 |
| InChIKey | FEBIEEGPEJEQJX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |