C17H16Cl4N2 — CID 3541146
1-[(2,3-dichlorophenyl)-(2,4-dichlorophenyl)methyl]piperazine (PubChem CID 3541146) has the molecular formula C17H16Cl4N2 and a molecular weight of 390.14 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)-(2,4-dichlorophenyl)methyl]piperazine.
| Compound Name | 1-[(2,3-dichlorophenyl)-(2,4-dichlorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3541146 |
| Molecular Formula | C17H16Cl4N2 |
| Molecular Weight | 390.14 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)-(2,4-dichlorophenyl)methyl]piperazine |
| SMILES | Clc1ccc(C(c2cccc(Cl)c2Cl)N2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl4N2/c18-11-4-5-12(15(20)10-11)17(23-8-6-22-7-9-23)13-2-1-3-14(19)16(13)21/h1-5,10,17,22H,6-9H2 |
| InChIKey | HWBNUJKKQMLNOT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.14 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |