C20H19Cl2N3 — CID 4209519
4-[(2,4-dichlorophenyl)-piperazin-1-ylmethyl]quinoline (PubChem CID 4209519) has the molecular formula C20H19Cl2N3 and a molecular weight of 372.30 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)-piperazin-1-ylmethyl]quinoline.
| Compound Name | 4-[(2,4-dichlorophenyl)-piperazin-1-ylmethyl]quinoline |
|---|---|
| PubChem CID | 4209519 |
| Molecular Formula | C20H19Cl2N3 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)-piperazin-1-ylmethyl]quinoline |
| SMILES | Clc1ccc(C(c2ccnc3ccccc23)N2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N3/c21-14-5-6-17(18(22)13-14)20(25-11-9-23-10-12-25)16-7-8-24-19-4-2-1-3-15(16)19/h1-8,13,20,23H,9-12H2 |
| InChIKey | VIAMKTIHMUAQOW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |