C17H19Cl2N3 — CID 4594125
1-[(2,4-dichlorophenyl)-(5-methyl-2-pyridinyl)methyl]piperazine (PubChem CID 4594125) has the molecular formula C17H19Cl2N3 and a molecular weight of 336.27 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)-(5-methyl-2-pyridinyl)methyl]piperazine.
| Compound Name | 1-[(2,4-dichlorophenyl)-(5-methyl-2-pyridinyl)methyl]piperazine |
|---|---|
| PubChem CID | 4594125 |
| Molecular Formula | C17H19Cl2N3 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)-(5-methyl-2-pyridinyl)methyl]piperazine |
| SMILES | Cc1ccc(C(c2ccc(Cl)cc2Cl)N2CCNCC2)nc1 |
| InChI | InChI=1S/C17H19Cl2N3/c1-12-2-5-16(21-11-12)17(22-8-6-20-7-9-22)14-4-3-13(18)10-15(14)19/h2-5,10-11,17,20H,6-9H2,1H3 |
| InChIKey | YOFWQZXVYRSIBH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |