C18H21Cl2N3 — CID 3567529
1-[(2,4-dichlorophenyl)-(5-methyl-2-pyridinyl)methyl]-1,4-diazepane (PubChem CID 3567529) has the molecular formula C18H21Cl2N3 and a molecular weight of 350.29 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)-(5-methyl-2-pyridinyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(2,4-dichlorophenyl)-(5-methyl-2-pyridinyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3567529 |
| Molecular Formula | C18H21Cl2N3 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)-(5-methyl-2-pyridinyl)methyl]-1,4-diazepane |
| SMILES | Cc1ccc(C(c2ccc(Cl)cc2Cl)N2CCCNCC2)nc1 |
| InChI | InChI=1S/C18H21Cl2N3/c1-13-3-6-17(22-12-13)18(23-9-2-7-21-8-10-23)15-5-4-14(19)11-16(15)20/h3-6,11-12,18,21H,2,7-10H2,1H3 |
| InChIKey | JHQAFCLBFSXMBA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |