C18H19Cl3N2 — CID 3791498
1-[(3-chlorophenyl)-(2,4-dichlorophenyl)methyl]-1,4-diazepane (PubChem CID 3791498) has the molecular formula C18H19Cl3N2 and a molecular weight of 369.72 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-(2,4-dichlorophenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(3-chlorophenyl)-(2,4-dichlorophenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3791498 |
| Molecular Formula | C18H19Cl3N2 |
| Molecular Weight | 369.72 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 1-[(3-chlorophenyl)-(2,4-dichlorophenyl)methyl]-1,4-diazepane |
| SMILES | Clc1cccc(C(c2ccc(Cl)cc2Cl)N2CCCNCC2)c1 |
| InChI | InChI=1S/C18H19Cl3N2/c19-14-4-1-3-13(11-14)18(23-9-2-7-22-8-10-23)16-6-5-15(20)12-17(16)21/h1,3-6,11-12,18,22H,2,7-10H2 |
| InChIKey | JQIKPKSJADRUFO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.72 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |