C20H25ClN2 — CID 4615569
1-[(3-chlorophenyl)-(3,5-dimethylphenyl)methyl]-1,4-diazepane (PubChem CID 4615569) has the molecular formula C20H25ClN2 and a molecular weight of 328.89 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-(3,5-dimethylphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(3-chlorophenyl)-(3,5-dimethylphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 4615569 |
| Molecular Formula | C20H25ClN2 |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-[(3-chlorophenyl)-(3,5-dimethylphenyl)methyl]-1,4-diazepane |
| SMILES | Cc1cc(C)cc(C(c2cccc(Cl)c2)N2CCCNCC2)c1 |
| InChI | InChI=1S/C20H25ClN2/c1-15-11-16(2)13-18(12-15)20(17-5-3-6-19(21)14-17)23-9-4-7-22-8-10-23/h3,5-6,11-14,20,22H,4,7-10H2,1-2H3 |
| InChIKey | RMLQKXQSIQCHNR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |