C20H26N2O — CID 3847657
1-[(3-methoxyphenyl)-(3-methylphenyl)methyl]-1,4-diazepane (PubChem CID 3847657) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)-(3-methylphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(3-methoxyphenyl)-(3-methylphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3847657 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 1-[(3-methoxyphenyl)-(3-methylphenyl)methyl]-1,4-diazepane |
| SMILES | COc1cccc(C(c2cccc(C)c2)N2CCCNCC2)c1 |
| InChI | InChI=1S/C20H26N2O/c1-16-6-3-7-17(14-16)20(22-12-5-10-21-11-13-22)18-8-4-9-19(15-18)23-2/h3-4,6-9,14-15,20-21H,5,10-13H2,1-2H3 |
| InChIKey | KCBUCEIDAGBORP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |