C21H28N2O — CID 3798790
1-[(3,5-dimethylphenyl)-(4-methoxyphenyl)methyl]-1,4-diazepane (PubChem CID 3798790) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenyl)-(4-methoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(3,5-dimethylphenyl)-(4-methoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3798790 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 1-[(3,5-dimethylphenyl)-(4-methoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1ccc(C(c2cc(C)cc(C)c2)N2CCCNCC2)cc1 |
| InChI | InChI=1S/C21H28N2O/c1-16-13-17(2)15-19(14-16)21(23-11-4-9-22-10-12-23)18-5-7-20(24-3)8-6-18/h5-8,13-15,21-22H,4,9-12H2,1-3H3 |
| InChIKey | LMUGZWYQARFLFH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |