C22H30N2O — CID 3808845
1-[(4-methoxyphenyl)-(4-propan-2-ylphenyl)methyl]-1,4-diazepane (PubChem CID 3808845) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)-(4-propan-2-ylphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(4-methoxyphenyl)-(4-propan-2-ylphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3808845 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 1-[(4-methoxyphenyl)-(4-propan-2-ylphenyl)methyl]-1,4-diazepane |
| SMILES | COc1ccc(C(c2ccc(C(C)C)cc2)N2CCCNCC2)cc1 |
| InChI | InChI=1S/C22H30N2O/c1-17(2)18-5-7-19(8-6-18)22(24-15-4-13-23-14-16-24)20-9-11-21(25-3)12-10-20/h5-12,17,22-23H,4,13-16H2,1-3H3 |
| InChIKey | BEUVRKPULSSDGJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |