C20H26N2OS — CID 4585079
1-[(4-methoxyphenyl)-(4-methylsulfanylphenyl)methyl]-1,4-diazepane (PubChem CID 4585079) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)-(4-methylsulfanylphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(4-methoxyphenyl)-(4-methylsulfanylphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 4585079 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-[(4-methoxyphenyl)-(4-methylsulfanylphenyl)methyl]-1,4-diazepane |
| SMILES | COc1ccc(C(c2ccc(SC)cc2)N2CCCNCC2)cc1 |
| InChI | InChI=1S/C20H26N2OS/c1-23-18-8-4-16(5-9-18)20(22-14-3-12-21-13-15-22)17-6-10-19(24-2)11-7-17/h4-11,20-21H,3,12-15H2,1-2H3 |
| InChIKey | JKTPNPHIQJGILM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |