C19H21NO4 — CID 135368630
4-[1,3-benzodioxol-5-yl-(2-methoxyphenyl)methyl]morpholine (PubChem CID 135368630) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[1,3-benzodioxol-5-yl-(2-methoxyphenyl)methyl]morpholine.
| Compound Name | 4-[1,3-benzodioxol-5-yl-(2-methoxyphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 135368630 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 4-[1,3-benzodioxol-5-yl-(2-methoxyphenyl)methyl]morpholine |
| SMILES | COc1ccccc1C(c1ccc2c(c1)OCO2)N1CCOCC1 |
| InChI | InChI=1S/C19H21NO4/c1-21-16-5-3-2-4-15(16)19(20-8-10-22-11-9-20)14-6-7-17-18(12-14)24-13-23-17/h2-7,12,19H,8-11,13H2,1H3 |
| InChIKey | MFZGZVWQYYLZTN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |