C16H15ClO3 — CID 63017209
5-[1-chloro-2-(2-methoxyphenyl)ethyl]-1,3-benzodioxole (PubChem CID 63017209) has the molecular formula C16H15ClO3 and a molecular weight of 290.75 g/mol. Its IUPAC name is 5-[1-chloro-2-(2-methoxyphenyl)ethyl]-1,3-benzodioxole.
| Compound Name | 5-[1-chloro-2-(2-methoxyphenyl)ethyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 63017209 |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5-[1-chloro-2-(2-methoxyphenyl)ethyl]-1,3-benzodioxole |
| SMILES | COc1ccccc1CC(Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15ClO3/c1-18-14-5-3-2-4-12(14)8-13(17)11-6-7-15-16(9-11)20-10-19-15/h2-7,9,13H,8,10H2,1H3 |
| InChIKey | ITLVSKWWQULCAX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|