C22H29ClN2O4 — CID 3740741
1-[(5-chloro-2-ethoxyphenyl)-(3,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 3740741) has the molecular formula C22H29ClN2O4 and a molecular weight of 420.94 g/mol. Its IUPAC name is 1-[(5-chloro-2-ethoxyphenyl)-(3,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(5-chloro-2-ethoxyphenyl)-(3,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3740741 |
| Molecular Formula | C22H29ClN2O4 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-[(5-chloro-2-ethoxyphenyl)-(3,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | CCOc1ccc(Cl)cc1C(c1cc(OC)c(OC)c(OC)c1)N1CCNCC1 |
| InChI | InChI=1S/C22H29ClN2O4/c1-5-29-18-7-6-16(23)14-17(18)21(25-10-8-24-9-11-25)15-12-19(26-2)22(28-4)20(13-15)27-3/h6-7,12-14,21,24H,5,8-11H2,1-4H3 |
| InChIKey | AHNDFTHMOYVXHT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |