C19H22ClFN2O — CID 3748492
1-[(5-chloro-2-ethoxyphenyl)-(4-fluorophenyl)methyl]piperazine (PubChem CID 3748492) has the molecular formula C19H22ClFN2O and a molecular weight of 348.85 g/mol. Its IUPAC name is 1-[(5-chloro-2-ethoxyphenyl)-(4-fluorophenyl)methyl]piperazine.
| Compound Name | 1-[(5-chloro-2-ethoxyphenyl)-(4-fluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3748492 |
| Molecular Formula | C19H22ClFN2O |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[(5-chloro-2-ethoxyphenyl)-(4-fluorophenyl)methyl]piperazine |
| SMILES | CCOc1ccc(Cl)cc1C(c1ccc(F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C19H22ClFN2O/c1-2-24-18-8-5-15(20)13-17(18)19(23-11-9-22-10-12-23)14-3-6-16(21)7-4-14/h3-8,13,19,22H,2,9-12H2,1H3 |
| InChIKey | GSTBANJVOBXCHX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |