C21H26Cl2N2O2 — CID 5216730
1-[(3,4-dichlorophenyl)-(3,4-diethoxyphenyl)methyl]piperazine (PubChem CID 5216730) has the molecular formula C21H26Cl2N2O2 and a molecular weight of 409.36 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)-(3,4-diethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(3,4-dichlorophenyl)-(3,4-diethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 5216730 |
| Molecular Formula | C21H26Cl2N2O2 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)-(3,4-diethoxyphenyl)methyl]piperazine |
| SMILES | CCOc1ccc(C(c2ccc(Cl)c(Cl)c2)N2CCNCC2)cc1OCC |
| InChI | InChI=1S/C21H26Cl2N2O2/c1-3-26-19-8-6-16(14-20(19)27-4-2)21(25-11-9-24-10-12-25)15-5-7-17(22)18(23)13-15/h5-8,13-14,21,24H,3-4,9-12H2,1-2H3 |
| InChIKey | OEZCXNQSQNZIMT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |