C26H28Cl2N2O2 — CID 3938650
1-[(3,4-dichlorophenyl)-(3-ethoxy-4-phenylmethoxyphenyl)methyl]piperazine (PubChem CID 3938650) has the molecular formula C26H28Cl2N2O2 and a molecular weight of 471.43 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)-(3-ethoxy-4-phenylmethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(3,4-dichlorophenyl)-(3-ethoxy-4-phenylmethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3938650 |
| Molecular Formula | C26H28Cl2N2O2 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)-(3-ethoxy-4-phenylmethoxyphenyl)methyl]piperazine |
| SMILES | CCOc1cc(C(c2ccc(Cl)c(Cl)c2)N2CCNCC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H28Cl2N2O2/c1-2-31-25-17-21(9-11-24(25)32-18-19-6-4-3-5-7-19)26(30-14-12-29-13-15-30)20-8-10-22(27)23(28)16-20/h3-11,16-17,26,29H,2,12-15,18H2,1H3 |
| InChIKey | XYPMAZBQKISOBH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |