C25H36N2O2 — CID 171311115
1-[(1R)-1-(3-ethoxy-4-phenylmethoxyphenyl)-4-methylpentyl]piperazine (PubChem CID 171311115) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 1-[(1R)-1-(3-ethoxy-4-phenylmethoxyphenyl)-4-methylpentyl]piperazine.
| Compound Name | 1-[(1R)-1-(3-ethoxy-4-phenylmethoxyphenyl)-4-methylpentyl]piperazine |
|---|---|
| PubChem CID | 171311115 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 1-[(1R)-1-(3-ethoxy-4-phenylmethoxyphenyl)-4-methylpentyl]piperazine |
| SMILES | CCOc1cc([C@@H](CCC(C)C)N2CCNCC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H36N2O2/c1-4-28-25-18-22(11-13-24(25)29-19-21-8-6-5-7-9-21)23(12-10-20(2)3)27-16-14-26-15-17-27/h5-9,11,13,18,20,23,26H,4,10,12,14-17,19H2,1-3H3/t23-/m1/s1 |
| InChIKey | DVEDTSNVLSFZRH-HSZRJFAPSA-N |
| XLogP | 5.05 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |