C21H28N2O3 — CID 3762656
1-[phenyl-(2,3,4-trimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 3762656) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-[phenyl-(2,3,4-trimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[phenyl-(2,3,4-trimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3762656 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1-[phenyl-(2,3,4-trimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1ccc(C(c2ccccc2)N2CCCNCC2)c(OC)c1OC |
| InChI | InChI=1S/C21H28N2O3/c1-24-18-11-10-17(20(25-2)21(18)26-3)19(16-8-5-4-6-9-16)23-14-7-12-22-13-15-23/h4-6,8-11,19,22H,7,12-15H2,1-3H3 |
| InChIKey | NCNVHPHDLMQSSE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |