C21H27BrN2O3 — CID 5158278
1-[(5-bromo-2-methoxyphenyl)-(2,3-dimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 5158278) has the molecular formula C21H27BrN2O3 and a molecular weight of 435.36 g/mol. Its IUPAC name is 1-[(5-bromo-2-methoxyphenyl)-(2,3-dimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(5-bromo-2-methoxyphenyl)-(2,3-dimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 5158278 |
| Molecular Formula | C21H27BrN2O3 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 1-[(5-bromo-2-methoxyphenyl)-(2,3-dimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1ccc(Br)cc1C(c1cccc(OC)c1OC)N1CCCNCC1 |
| InChI | InChI=1S/C21H27BrN2O3/c1-25-18-9-8-15(22)14-17(18)20(24-12-5-10-23-11-13-24)16-6-4-7-19(26-2)21(16)27-3/h4,6-9,14,20,23H,5,10-13H2,1-3H3 |
| InChIKey | SXILOLXNUNTPDK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |