C20H25BrN2O — CID 3809899
1-[(5-bromo-2-methoxyphenyl)-(3,5-dimethylphenyl)methyl]piperazine (PubChem CID 3809899) has the molecular formula C20H25BrN2O and a molecular weight of 389.34 g/mol. Its IUPAC name is 1-[(5-bromo-2-methoxyphenyl)-(3,5-dimethylphenyl)methyl]piperazine.
| Compound Name | 1-[(5-bromo-2-methoxyphenyl)-(3,5-dimethylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3809899 |
| Molecular Formula | C20H25BrN2O |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-[(5-bromo-2-methoxyphenyl)-(3,5-dimethylphenyl)methyl]piperazine |
| SMILES | COc1ccc(Br)cc1C(c1cc(C)cc(C)c1)N1CCNCC1 |
| InChI | InChI=1S/C20H25BrN2O/c1-14-10-15(2)12-16(11-14)20(23-8-6-22-7-9-23)18-13-17(21)4-5-19(18)24-3/h4-5,10-13,20,22H,6-9H2,1-3H3 |
| InChIKey | WLDUJIWOEHHRIW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |