C25H30N2O3 — CID 4296709
1-[naphthalen-2-yl-(2,3,4-trimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 4296709) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[naphthalen-2-yl-(2,3,4-trimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[naphthalen-2-yl-(2,3,4-trimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 4296709 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 1-[naphthalen-2-yl-(2,3,4-trimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1ccc(C(c2ccc3ccccc3c2)N2CCCNCC2)c(OC)c1OC |
| InChI | InChI=1S/C25H30N2O3/c1-28-22-12-11-21(24(29-2)25(22)30-3)23(27-15-6-13-26-14-16-27)20-10-9-18-7-4-5-8-19(18)17-20/h4-5,7-12,17,23,26H,6,13-16H2,1-3H3 |
| InChIKey | TZBJVRITQHRRTK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |