C24H27BrN2O2 — CID 3337520
1-[(2-bromo-4,5-dimethoxyphenyl)-naphthalen-2-ylmethyl]-1,4-diazepane (PubChem CID 3337520) has the molecular formula C24H27BrN2O2 and a molecular weight of 455.40 g/mol. Its IUPAC name is 1-[(2-bromo-4,5-dimethoxyphenyl)-naphthalen-2-ylmethyl]-1,4-diazepane.
| Compound Name | 1-[(2-bromo-4,5-dimethoxyphenyl)-naphthalen-2-ylmethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3337520 |
| Molecular Formula | C24H27BrN2O2 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-[(2-bromo-4,5-dimethoxyphenyl)-naphthalen-2-ylmethyl]-1,4-diazepane |
| SMILES | COc1cc(Br)c(C(c2ccc3ccccc3c2)N2CCCNCC2)cc1OC |
| InChI | InChI=1S/C24H27BrN2O2/c1-28-22-15-20(21(25)16-23(22)29-2)24(27-12-5-10-26-11-13-27)19-9-8-17-6-3-4-7-18(17)14-19/h3-4,6-9,14-16,24,26H,5,10-13H2,1-2H3 |
| InChIKey | NIWDFZYTBTULNI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |