C21H26Cl2N2O3 — CID 3504603
1-[(3,4-dichlorophenyl)-(2,4,5-trimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 3504603) has the molecular formula C21H26Cl2N2O3 and a molecular weight of 425.36 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)-(2,4,5-trimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(3,4-dichlorophenyl)-(2,4,5-trimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3504603 |
| Molecular Formula | C21H26Cl2N2O3 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)-(2,4,5-trimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1cc(OC)c(C(c2ccc(Cl)c(Cl)c2)N2CCCNCC2)cc1OC |
| InChI | InChI=1S/C21H26Cl2N2O3/c1-26-18-13-20(28-3)19(27-2)12-15(18)21(25-9-4-7-24-8-10-25)14-5-6-16(22)17(23)11-14/h5-6,11-13,21,24H,4,7-10H2,1-3H3 |
| InChIKey | VMGUGOHLTFENGI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |